C20H13NO2S — CID 16548697
naphthalen-1-yl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 16548697) has the molecular formula C20H13NO2S and a molecular weight of 331.40 g/mol. Its IUPAC name is naphthalen-1-yl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | naphthalen-1-yl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16548697 |
| Molecular Formula | C20H13NO2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | naphthalen-1-yl (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H13NO2S/c22-20(13-12-19-21-16-9-3-4-11-18(16)24-19)23-17-10-5-7-14-6-1-2-8-15(14)17/h1-13H/b13-12+ |
| InChIKey | LIHVRGHXCOFLFZ-OUKQBFOZSA-N |
| XLogP | 5.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|