C17H11NO4S — CID 4826534
1,3-benzodioxol-5-yl 3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 4826534) has the molecular formula C17H11NO4S and a molecular weight of 325.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4826534 |
| Molecular Formula | C17H11NO4S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1nc2ccccc2s1)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11NO4S/c19-17(22-11-5-6-13-14(9-11)21-10-20-13)8-7-16-18-12-3-1-2-4-15(12)23-16/h1-9H,10H2 |
| InChIKey | FSZSSFGBRFVICS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|