C14H11NO4S — CID 7907500
[(3S)-2-oxooxolan-3-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 7907500) has the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7907500 |
| Molecular Formula | C14H11NO4S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)O[C@H]1CCOC1=O |
| InChI | InChI=1S/C14H11NO4S/c16-13(19-10-7-8-18-14(10)17)6-5-12-15-9-3-1-2-4-11(9)20-12/h1-6,10H,7-8H2/b6-5+/t10-/m0/s1 |
| InChIKey | XIFGXTORPJMJIC-PORFMDCZSA-N |
| XLogP | 2.17 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|