C18H15NO3S — CID 55331940
(2-ethoxyphenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 55331940) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is (2-ethoxyphenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | (2-ethoxyphenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55331940 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (2-ethoxyphenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | CCOc1ccccc1OC(=O)/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H15NO3S/c1-2-21-14-8-4-5-9-15(14)22-18(20)12-11-17-19-13-7-3-6-10-16(13)23-17/h3-12H,2H2,1H3/b12-11+ |
| InChIKey | GQMOHFJYQSESSH-VAWYXSNFSA-N |
| XLogP | 4.31 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|