C18H14ClNO2S — CID 7907681
[(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 7907681) has the molecular formula C18H14ClNO2S and a molecular weight of 343.84 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7907681 |
| Molecular Formula | C18H14ClNO2S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1nc2ccccc2s1)c1ccccc1Cl |
| InChI | InChI=1S/C18H14ClNO2S/c1-12(13-6-2-3-7-14(13)19)22-18(21)11-10-17-20-15-8-4-5-9-16(15)23-17/h2-12H,1H3/b11-10+/t12-/m1/s1 |
| InChIKey | XDAVXVFWDHWEPQ-HCRIHEDKSA-N |
| XLogP | 5.27 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|