C21H19NO4S — CID 7907688
[(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 7907688) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is [(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7907688 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | CCOc1ccc(C(=O)[C@H](C)OC(=O)/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H19NO4S/c1-3-25-16-10-8-15(9-11-16)21(24)14(2)26-20(23)13-12-19-22-17-6-4-5-7-18(17)27-19/h4-14H,3H2,1-2H3/b13-12+/t14-/m0/s1 |
| InChIKey | VQJTZALKQGHPQN-FNDVETGQSA-N |
| XLogP | 4.52 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|