C16H9BrFNO2S — CID 16551435
(4-bromo-2-fluorophenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 16551435) has the molecular formula C16H9BrFNO2S and a molecular weight of 378.22 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | (4-bromo-2-fluorophenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16551435 |
| Molecular Formula | C16H9BrFNO2S |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | (4-bromo-2-fluorophenyl) (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H9BrFNO2S/c17-10-5-6-13(11(18)9-10)21-16(20)8-7-15-19-12-3-1-2-4-14(12)22-15/h1-9H/b8-7+ |
| InChIKey | PRHSSQTZLHTTKP-BQYQJAHWSA-N |
| XLogP | 4.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|