C16H10ClNO3S2 — CID 71953152
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 71953152) has the molecular formula C16H10ClNO3S2 and a molecular weight of 363.85 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71953152 |
| Molecular Formula | C16H10ClNO3S2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1nc2ccccc2s1)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H10ClNO3S2/c17-14-6-5-13(22-14)11(19)9-21-16(20)8-7-15-18-10-3-1-2-4-12(10)23-15/h1-8H,9H2 |
| InChIKey | LZQMVLDYPNSMME-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|