C12H11NO3S — CID 46906543
ethyl (Z)-3-(1,3-benzothiazol-2-yloxy)prop-2-enoate (PubChem CID 46906543) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is ethyl (Z)-3-(1,3-benzothiazol-2-yloxy)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(1,3-benzothiazol-2-yloxy)prop-2-enoate |
|---|---|
| PubChem CID | 46906543 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | ethyl (Z)-3-(1,3-benzothiazol-2-yloxy)prop-2-enoate |
| SMILES | CCOC(=O)/C=C\Oc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H11NO3S/c1-2-15-11(14)7-8-16-12-13-9-5-3-4-6-10(9)17-12/h3-8H,2H2,1H3/b8-7- |
| InChIKey | DQHIUHWRENFISH-FPLPWBNLSA-N |
| XLogP | 2.75 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|