C8H7NOS2 — CID 175220247
2-methylsulfanyloxy-1,3-benzothiazole (PubChem CID 175220247) has the molecular formula C8H7NOS2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-methylsulfanyloxy-1,3-benzothiazole.
| Compound Name | 2-methylsulfanyloxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 175220247 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 2-methylsulfanyloxy-1,3-benzothiazole |
| SMILES | CSOc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NOS2/c1-11-10-8-9-6-4-2-3-5-7(6)12-8/h2-5H,1H3 |
| InChIKey | MWWGLLYTIHPPBV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|