C16H15NO3S — CID 162662494
2-[(3,5-dimethoxyphenyl)methoxy]-1,3-benzothiazole (PubChem CID 162662494) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methoxy]-1,3-benzothiazole.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methoxy]-1,3-benzothiazole |
|---|---|
| PubChem CID | 162662494 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methoxy]-1,3-benzothiazole |
| SMILES | COc1cc(COc2nc3ccccc3s2)cc(OC)c1 |
| InChI | InChI=1S/C16H15NO3S/c1-18-12-7-11(8-13(9-12)19-2)10-20-16-17-14-5-3-4-6-15(14)21-16/h3-9H,10H2,1-2H3 |
| InChIKey | LSYXUGVUOSNPHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |