C16H16N2O3S — CID 70566955
2-(1,3-benzothiazol-2-yloxy)acetic acid;N-methylaniline (PubChem CID 70566955) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yloxy)acetic acid;N-methylaniline.
| Compound Name | 2-(1,3-benzothiazol-2-yloxy)acetic acid;N-methylaniline |
|---|---|
| PubChem CID | 70566955 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yloxy)acetic acid;N-methylaniline |
| SMILES | CNc1ccccc1.O=C(O)COc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H7NO3S.C7H9N/c11-8(12)5-13-9-10-6-3-1-2-4-7(6)14-9;1-8-7-5-3-2-4-6-7/h1-4H,5H2,(H,11,12);2-6,8H,1H3 |
| InChIKey | JZBGEYAYCWCLPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |