C17H15NO4S — CID 57116230
methyl 3-[4-(1,3-benzothiazol-2-yloxy)phenoxy]propanoate (PubChem CID 57116230) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 3-[4-(1,3-benzothiazol-2-yloxy)phenoxy]propanoate.
| Compound Name | methyl 3-[4-(1,3-benzothiazol-2-yloxy)phenoxy]propanoate |
|---|---|
| PubChem CID | 57116230 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl 3-[4-(1,3-benzothiazol-2-yloxy)phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(Oc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H15NO4S/c1-20-16(19)10-11-21-12-6-8-13(9-7-12)22-17-18-14-4-2-3-5-15(14)23-17/h2-9H,10-11H2,1H3 |
| InChIKey | MRUZIHWSRHGDCL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |