C14H18N2O2S2 — CID 67214100
2-(1,3-benzothiazol-2-yloxy)-N-tert-butyl-2-methylsulfanylacetamide (PubChem CID 67214100) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yloxy)-N-tert-butyl-2-methylsulfanylacetamide.
| Compound Name | 2-(1,3-benzothiazol-2-yloxy)-N-tert-butyl-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 67214100 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yloxy)-N-tert-butyl-2-methylsulfanylacetamide |
| SMILES | CSC(Oc1nc2ccccc2s1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H18N2O2S2/c1-14(2,3)16-11(17)12(19-4)18-13-15-9-7-5-6-8-10(9)20-13/h5-8,12H,1-4H3,(H,16,17) |
| InChIKey | JBEHLWMWJRBOGU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|