C13H17N3O2S3 — CID 87176107
O-(1,3-benzothiazol-2-yl) N,N-diethylcarbamothioate;carbamothioic S-acid (PubChem CID 87176107) has the molecular formula C13H17N3O2S3 and a molecular weight of 343.50 g/mol. Its IUPAC name is O-(1,3-benzothiazol-2-yl) N,N-diethylcarbamothioate;carbamothioic S-acid.
| Compound Name | O-(1,3-benzothiazol-2-yl) N,N-diethylcarbamothioate;carbamothioic S-acid |
|---|---|
| PubChem CID | 87176107 |
| Molecular Formula | C13H17N3O2S3 |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | O-(1,3-benzothiazol-2-yl) N,N-diethylcarbamothioate;carbamothioic S-acid |
| SMILES | CCN(CC)C(=S)Oc1nc2ccccc2s1.NC(=O)S |
| InChI | InChI=1S/C12H14N2OS2.CH3NOS/c1-3-14(4-2)12(16)15-11-13-9-7-5-6-8-10(9)17-11;2-1(3)4/h5-8H,3-4H2,1-2H3;(H3,2,3,4) |
| InChIKey | OGXDGHKXNBOQIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|