ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate

C13H16N2O2S — CID 62004564

IUPACethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate
SMILESCCOC(=O)CN(CC)c1nc2ccccc2s1
InChIInChI=1S/C13H16N2O2S/c1-3-15(9-12(16)17-4-2)13-14-10-7-5-6-8-11(10)18-13/h5-8H,3-4,9H2,1-2H3
InChIKeyWKEWXHAGZUUMHV-UHFFFAOYSA-N
MW264.35 g/mol
LogP2.69
Rot. Bonds5

About ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate

ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate (PubChem CID 62004564) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate
PubChem CID62004564
Molecular FormulaC13H16N2O2S
Molecular Weight264.35 g/mol
Exact Mass264.09
IUPAC Nameethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate
SMILESCCOC(=O)CN(CC)c1nc2ccccc2s1
InChIInChI=1S/C13H16N2O2S/c1-3-15(9-12(16)17-4-2)13-14-10-7-5-6-8-11(10)18-13/h5-8H,3-4,9H2,1-2H3
InChIKeyWKEWXHAGZUUMHV-UHFFFAOYSA-N
XLogP2.69
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.35
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
The IUPAC name of ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate (CID 62004564) is ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate.
What is the SMILES notation for ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
The canonical SMILES for ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate is CCOC(=O)CN(CC)c1nc2ccccc2s1.
What is the InChIKey of ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
The InChIKey is WKEWXHAGZUUMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-3-15(9-12(16)17-4-2)13-14-10-7-5-6-8-11(10)18-13/h5-8H,3-4,9H2,1-2H3.
What are the key properties of ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate has a molecular weight of 264.35 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate is sourced from PubChem (CID 62004564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).