C21H28N2O4S — CID 89190970
ethyl 2-[2-(1,3-benzothiazol-2-yl)ethenyl-(2-hexoxy-2-oxoethyl)amino]acetate (PubChem CID 89190970) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-benzothiazol-2-yl)ethenyl-(2-hexoxy-2-oxoethyl)amino]acetate.
| Compound Name | ethyl 2-[2-(1,3-benzothiazol-2-yl)ethenyl-(2-hexoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 89190970 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | ethyl 2-[2-(1,3-benzothiazol-2-yl)ethenyl-(2-hexoxy-2-oxoethyl)amino]acetate |
| SMILES | CCCCCCOC(=O)CN(C=Cc1nc2ccccc2s1)CC(=O)OCC |
| InChI | InChI=1S/C21H28N2O4S/c1-3-5-6-9-14-27-21(25)16-23(15-20(24)26-4-2)13-12-19-22-17-10-7-8-11-18(17)28-19/h7-8,10-13H,3-6,9,14-16H2,1-2H3 |
| InChIKey | IZHVBZWDMWBNHY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|