C14H17NOS — CID 166523778
1-(1,3-benzothiazol-2-yl)heptan-1-one (PubChem CID 166523778) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)heptan-1-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 166523778 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17NOS/c1-2-3-4-5-9-12(16)14-15-11-8-6-7-10-13(11)17-14/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | FGFHLNVYGUZZIV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|