C12H12N2O3S — CID 71072086
1,3-benzothiazole-2-carbonyl(propyl)carbamic acid (PubChem CID 71072086) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid.
| Compound Name | 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid |
|---|---|
| PubChem CID | 71072086 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid |
| SMILES | CCCN(C(=O)O)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-7-14(12(16)17)11(15)10-13-8-5-3-4-6-9(8)18-10/h3-6H,2,7H2,1H3,(H,16,17) |
| InChIKey | CVNIKVDTOFWUMZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |