1,3-benzothiazole-2-carbonyl(propyl)carbamic acid

C12H12N2O3S — CID 71072086

IUPAC1,3-benzothiazole-2-carbonyl(propyl)carbamic acid
SMILESCCCN(C(=O)O)C(=O)c1nc2ccccc2s1
InChIInChI=1S/C12H12N2O3S/c1-2-7-14(12(16)17)11(15)10-13-8-5-3-4-6-9(8)18-10/h3-6H,2,7H2,1H3,(H,16,17)
InChIKeyCVNIKVDTOFWUMZ-UHFFFAOYSA-N
MW264.31 g/mol
LogP2.83
Rot. Bonds3

About 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid

1,3-benzothiazole-2-carbonyl(propyl)carbamic acid (PubChem CID 71072086) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid.

Molecular Properties

Compound Name1,3-benzothiazole-2-carbonyl(propyl)carbamic acid
PubChem CID71072086
Molecular FormulaC12H12N2O3S
Molecular Weight264.31 g/mol
Exact Mass264.06
IUPAC Name1,3-benzothiazole-2-carbonyl(propyl)carbamic acid
SMILESCCCN(C(=O)O)C(=O)c1nc2ccccc2s1
InChIInChI=1S/C12H12N2O3S/c1-2-7-14(12(16)17)11(15)10-13-8-5-3-4-6-9(8)18-10/h3-6H,2,7H2,1H3,(H,16,17)
InChIKeyCVNIKVDTOFWUMZ-UHFFFAOYSA-N
XLogP2.83
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.31
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid?
The IUPAC name of 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid (CID 71072086) is 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid.
What is the SMILES notation for 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid?
The canonical SMILES for 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid is CCCN(C(=O)O)C(=O)c1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid?
The InChIKey is CVNIKVDTOFWUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S/c1-2-7-14(12(16)17)11(15)10-13-8-5-3-4-6-9(8)18-10/h3-6H,2,7H2,1H3,(H,16,17).
What are the key properties of 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid?
1,3-benzothiazole-2-carbonyl(propyl)carbamic acid has a molecular weight of 264.31 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole-2-carbonyl(propyl)carbamic acid is sourced from PubChem (CID 71072086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).