C10H10N2O2S3 — CID 88817517
1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid (PubChem CID 88817517) has the molecular formula C10H10N2O2S3 and a molecular weight of 286.40 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid.
| Compound Name | 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid |
|---|---|
| PubChem CID | 88817517 |
| Molecular Formula | C10H10N2O2S3 |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid |
| SMILES | CCSSN(C(=O)O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H10N2O2S3/c1-2-15-17-12(10(13)14)9-11-7-5-3-4-6-8(7)16-9/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | JRYMWFFTLDHNPT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|