1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid

C10H10N2O2S3 — CID 88817517

IUPAC1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid
SMILESCCSSN(C(=O)O)c1nc2ccccc2s1
InChIInChI=1S/C10H10N2O2S3/c1-2-15-17-12(10(13)14)9-11-7-5-3-4-6-8(7)16-9/h3-6H,2H2,1H3,(H,13,14)
InChIKeyJRYMWFFTLDHNPT-UHFFFAOYSA-N
MW286.40 g/mol
LogP4.10
Rot. Bonds4

About 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid

1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid (PubChem CID 88817517) has the molecular formula C10H10N2O2S3 and a molecular weight of 286.40 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid.

Molecular Properties

Compound Name1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid
PubChem CID88817517
Molecular FormulaC10H10N2O2S3
Molecular Weight286.40 g/mol
Exact Mass285.99
IUPAC Name1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid
SMILESCCSSN(C(=O)O)c1nc2ccccc2s1
InChIInChI=1S/C10H10N2O2S3/c1-2-15-17-12(10(13)14)9-11-7-5-3-4-6-8(7)16-9/h3-6H,2H2,1H3,(H,13,14)
InChIKeyJRYMWFFTLDHNPT-UHFFFAOYSA-N
XLogP4.10
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.40
LogP ≤ 54.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid?
The IUPAC name of 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid (CID 88817517) is 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid.
What is the SMILES notation for 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid?
The canonical SMILES for 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid is CCSSN(C(=O)O)c1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid?
The InChIKey is JRYMWFFTLDHNPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S3/c1-2-15-17-12(10(13)14)9-11-7-5-3-4-6-8(7)16-9/h3-6H,2H2,1H3,(H,13,14).
What are the key properties of 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid?
1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid has a molecular weight of 286.40 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-yl-(ethyldisulfanyl)carbamic acid is sourced from PubChem (CID 88817517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).