C10H10N2S3 — CID 804828
methyl N-(1,3-benzothiazol-2-yl)-N-methylcarbamodithioate (PubChem CID 804828) has the molecular formula C10H10N2S3 and a molecular weight of 254.41 g/mol. Its IUPAC name is methyl N-(1,3-benzothiazol-2-yl)-N-methylcarbamodithioate.
| Compound Name | methyl N-(1,3-benzothiazol-2-yl)-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 804828 |
| Molecular Formula | C10H10N2S3 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | methyl N-(1,3-benzothiazol-2-yl)-N-methylcarbamodithioate |
| SMILES | CSC(=S)N(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H10N2S3/c1-12(10(13)14-2)9-11-7-5-3-4-6-8(7)15-9/h3-6H,1-2H3 |
| InChIKey | SHZWUVHDEYKFGY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|