C10H11ClN2S — CID 63392267
N-(2-chloroethyl)-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 63392267) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-chloroethyl)-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 63392267 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | N-(2-chloroethyl)-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CN(CCCl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H11ClN2S/c1-13(7-6-11)10-12-8-4-2-3-5-9(8)14-10/h2-5H,6-7H2,1H3 |
| InChIKey | BCAOYRJOWVTIIL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|