C13H16N2S — CID 133398444
N-(2-cyclopropylethyl)-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 133398444) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-cyclopropylethyl)-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 133398444 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(2-cyclopropylethyl)-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CN(CCC1CC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H16N2S/c1-15(9-8-10-6-7-10)13-14-11-4-2-3-5-12(11)16-13/h2-5,10H,6-9H2,1H3 |
| InChIKey | GOLRMFMZNZJNFI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |