C16H23N3OS — CID 90605326
2-[1,3-benzothiazol-2-yl(methyl)amino]-N,N-dipropylacetamide (PubChem CID 90605326) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-[1,3-benzothiazol-2-yl(methyl)amino]-N,N-dipropylacetamide.
| Compound Name | 2-[1,3-benzothiazol-2-yl(methyl)amino]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 90605326 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[1,3-benzothiazol-2-yl(methyl)amino]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H23N3OS/c1-4-10-19(11-5-2)15(20)12-18(3)16-17-13-8-6-7-9-14(13)21-16/h6-9H,4-5,10-12H2,1-3H3 |
| InChIKey | MLOZSZGSUCNUIV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |