C15H18N4O2S — CID 90605476
4-[2-[1,3-benzothiazol-2-yl(methyl)amino]acetyl]piperazine-1-carbaldehyde (PubChem CID 90605476) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-[2-[1,3-benzothiazol-2-yl(methyl)amino]acetyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-[1,3-benzothiazol-2-yl(methyl)amino]acetyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 90605476 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-[2-[1,3-benzothiazol-2-yl(methyl)amino]acetyl]piperazine-1-carbaldehyde |
| SMILES | CN(CC(=O)N1CCN(C=O)CC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H18N4O2S/c1-17(15-16-12-4-2-3-5-13(12)22-15)10-14(21)19-8-6-18(11-20)7-9-19/h2-5,11H,6-10H2,1H3 |
| InChIKey | HGESUJUITGEBMG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|