C33H42N6O2S2 — CID 59031007
1,7-bis[4-[1,3-benzothiazol-2-yl(methyl)amino]piperidin-1-yl]heptane-1,7-dione (PubChem CID 59031007) has the molecular formula C33H42N6O2S2 and a molecular weight of 618.87 g/mol. Its IUPAC name is 1,7-bis[4-[1,3-benzothiazol-2-yl(methyl)amino]piperidin-1-yl]heptane-1,7-dione.
| Compound Name | 1,7-bis[4-[1,3-benzothiazol-2-yl(methyl)amino]piperidin-1-yl]heptane-1,7-dione |
|---|---|
| PubChem CID | 59031007 |
| Molecular Formula | C33H42N6O2S2 |
| Molecular Weight | 618.87 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 1,7-bis[4-[1,3-benzothiazol-2-yl(methyl)amino]piperidin-1-yl]heptane-1,7-dione |
| SMILES | CN(c1nc2ccccc2s1)C1CCN(C(=O)CCCCCC(=O)N2CCC(N(C)c3nc4ccccc4s3)CC2)CC1 |
| InChI | InChI=1S/C33H42N6O2S2/c1-36(32-34-26-10-6-8-12-28(26)42-32)24-16-20-38(21-17-24)30(40)14-4-3-5-15-31(41)39-22-18-25(19-23-39)37(2)33-35-27-11-7-9-13-29(27)43-33/h6-13,24-25H,3-5,14-23H2,1-2H3 |
| InChIKey | SQTUUHFKYOGWJV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.87 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|