C21H21N3O2S — CID 9166952
1-acetyl-N-(1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide (PubChem CID 9166952) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-acetyl-N-(1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 9166952 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-acetyl-N-(1,3-benzothiazol-2-yl)-N-phenylpiperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N(c2ccccc2)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H21N3O2S/c1-15(25)23-13-11-16(12-14-23)20(26)24(17-7-3-2-4-8-17)21-22-18-9-5-6-10-19(18)27-21/h2-10,16H,11-14H2,1H3 |
| InChIKey | VAYAFAAEEBFMIS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |