C14H13Cl2N3OS — CID 175170156
1-(1,3-benzothiazol-2-yl)-1-phenylurea;dihydrochloride (PubChem CID 175170156) has the molecular formula C14H13Cl2N3OS and a molecular weight of 342.25 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1-phenylurea;dihydrochloride.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1-phenylurea;dihydrochloride |
|---|---|
| PubChem CID | 175170156 |
| Molecular Formula | C14H13Cl2N3OS |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1-phenylurea;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)N(c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11N3OS.2ClH/c15-13(18)17(10-6-2-1-3-7-10)14-16-11-8-4-5-9-12(11)19-14;;/h1-9H,(H2,15,18);2*1H |
| InChIKey | UOUFHZISTUINHO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |