C9H9N3O2S — CID 77174878
methyl N-amino-N-(1,3-benzothiazol-2-yl)carbamate (PubChem CID 77174878) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is methyl N-amino-N-(1,3-benzothiazol-2-yl)carbamate.
| Compound Name | methyl N-amino-N-(1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 77174878 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | methyl N-amino-N-(1,3-benzothiazol-2-yl)carbamate |
| SMILES | COC(=O)N(N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9N3O2S/c1-14-9(13)12(10)8-11-6-4-2-3-5-7(6)15-8/h2-5H,10H2,1H3 |
| InChIKey | GITYQLRRZVJMEO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|