About N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide
N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 24603331) has the molecular formula C22H25N3O3S2
and a molecular weight of 443.59 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide |
| PubChem CID | 24603331 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CCc1ccc(N(C(=O)C2CCN(S(C)(=O)=O)CC2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-3-16-8-10-18(11-9-16)25(22-23-19-6-4-5-7-20(19)29-22)21(26)17-12-14-24(15-13-17)30(2,27)28/h4-11,17H,3,12-15H2,1-2H3 |
| InChIKey | PMZJEEDNUNRZRN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide?
The IUPAC name of N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide (CID 24603331) is N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide.
What is the SMILES notation for N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide?
The canonical SMILES for N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide is CCc1ccc(N(C(=O)C2CCN(S(C)(=O)=O)CC2)c2nc3ccccc3s2)cc1.
What is the InChIKey of N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide?
The InChIKey is PMZJEEDNUNRZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3S2/c1-3-16-8-10-18(11-9-16)25(22-23-19-6-4-5-7-20(19)29-22)21(26)17-12-14-24(15-13-17)30(2,27)28/h4-11,17H,3,12-15H2,1-2H3.
What are the key properties of N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide?
N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide has a molecular weight of 443.59 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-1-methylsulfonylpiperidine-4-carboxamide is sourced from PubChem (CID 24603331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).