C23H23N3O2S2 — CID 55333887
N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 55333887) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 55333887 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(4-ethylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CCc1ccc(N(C(=O)C2CSC3(C)CCC(=O)N23)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H23N3O2S2/c1-3-15-8-10-16(11-9-15)25(22-24-17-6-4-5-7-19(17)30-22)21(28)18-14-29-23(2)13-12-20(27)26(18)23/h4-11,18H,3,12-14H2,1-2H3 |
| InChIKey | CZWCLVDPDLBVOD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |