C11H11ClF2N2S — CID 107489824
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine (PubChem CID 107489824) has the molecular formula C11H11ClF2N2S and a molecular weight of 276.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 107489824 |
| Molecular Formula | C11H11ClF2N2S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)CN(CCCl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11ClF2N2S/c12-5-6-16(7-10(13)14)11-15-8-3-1-2-4-9(8)17-11/h1-4,10H,5-7H2 |
| InChIKey | RCXHXODSXGDKIQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|