C11H11N3S — CID 118066757
1-(1,3-benzothiazol-2-yl)-1-but-3-ynylhydrazine (PubChem CID 118066757) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1-but-3-ynylhydrazine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1-but-3-ynylhydrazine |
|---|---|
| PubChem CID | 118066757 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1-but-3-ynylhydrazine |
| SMILES | C#CCCN(N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11N3S/c1-2-3-8-14(12)11-13-9-6-4-5-7-10(9)15-11/h1,4-7H,3,8,12H2 |
| InChIKey | SUJYZOTYTFTNME-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|