C11H15N3O2S — CID 139379111
2-[2-[amino(1,3-benzothiazol-2-yl)amino]ethoxy]ethanol (PubChem CID 139379111) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-[2-[amino(1,3-benzothiazol-2-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[amino(1,3-benzothiazol-2-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 139379111 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-[2-[amino(1,3-benzothiazol-2-yl)amino]ethoxy]ethanol |
| SMILES | NN(CCOCCO)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H15N3O2S/c12-14(5-7-16-8-6-15)11-13-9-3-1-2-4-10(9)17-11/h1-4,15H,5-8,12H2 |
| InChIKey | HCKJQMOWPCCJLU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|