C13H18N2OS — CID 61146234
3-[1,3-benzothiazol-2-yl(propan-2-yl)amino]propan-1-ol (PubChem CID 61146234) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-[1,3-benzothiazol-2-yl(propan-2-yl)amino]propan-1-ol.
| Compound Name | 3-[1,3-benzothiazol-2-yl(propan-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 61146234 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-[1,3-benzothiazol-2-yl(propan-2-yl)amino]propan-1-ol |
| SMILES | CC(C)N(CCCO)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H18N2OS/c1-10(2)15(8-5-9-16)13-14-11-6-3-4-7-12(11)17-13/h3-4,6-7,10,16H,5,8-9H2,1-2H3 |
| InChIKey | ZMBPDMSLILPVRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |