C19H22N2S — CID 141167970
N-butyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine (PubChem CID 141167970) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is N-butyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-butyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 141167970 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-butyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine |
| SMILES | CCCCN(CCc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H22N2S/c1-2-3-14-21(15-13-16-9-5-4-6-10-16)19-20-17-11-7-8-12-18(17)22-19/h4-12H,2-3,13-15H2,1H3 |
| InChIKey | XYAMGGYTAOFMMR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |