C16H12F2N2O2S — CID 17470701
N-(1,3-benzothiazol-2-yl)-4-(difluoromethoxy)-N-methylbenzamide (PubChem CID 17470701) has the molecular formula C16H12F2N2O2S and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(difluoromethoxy)-N-methylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(difluoromethoxy)-N-methylbenzamide |
|---|---|
| PubChem CID | 17470701 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(difluoromethoxy)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(OC(F)F)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12F2N2O2S/c1-20(16-19-12-4-2-3-5-13(12)23-16)14(21)10-6-8-11(9-7-10)22-15(17)18/h2-9,15H,1H3 |
| InChIKey | LTZLWFDMBRPTPE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |