C15H15N5O2S3 — CID 121029828
N-[5-[2-oxo-2-(propylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide (PubChem CID 121029828) has the molecular formula C15H15N5O2S3 and a molecular weight of 393.52 g/mol. Its IUPAC name is N-[5-[2-oxo-2-(propylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[5-[2-oxo-2-(propylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 121029828 |
| Molecular Formula | C15H15N5O2S3 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-[5-[2-oxo-2-(propylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide |
| SMILES | CCCNC(=O)CSc1nnc(NC(=O)c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C15H15N5O2S3/c1-2-7-16-11(21)8-23-15-20-19-14(25-15)18-12(22)13-17-9-5-3-4-6-10(9)24-13/h3-6H,2,7-8H2,1H3,(H,16,21)(H,18,19,22) |
| InChIKey | ZWLWOVQJHGQISZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|