C12H21N5O2S2 — CID 7385393
2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide (PubChem CID 7385393) has the molecular formula C12H21N5O2S2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 7385393 |
| Molecular Formula | C12H21N5O2S2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nnc(NC(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C12H21N5O2S2/c1-5-6-13-8(18)7-20-11-17-16-10(21-11)14-9(19)15-12(2,3)4/h5-7H2,1-4H3,(H,13,18)(H2,14,15,16,19) |
| InChIKey | OWDJRWUGLSVOGC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|