C13H22N4O2S2 — CID 3220441
N-[5-[2-(tert-butylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbutanamide (PubChem CID 3220441) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[5-[2-(tert-butylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbutanamide.
| Compound Name | N-[5-[2-(tert-butylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 3220441 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[5-[2-(tert-butylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1nnc(SCC(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C13H22N4O2S2/c1-6-8(2)10(19)14-11-16-17-12(21-11)20-7-9(18)15-13(3,4)5/h8H,6-7H2,1-5H3,(H,15,18)(H,14,16,19) |
| InChIKey | MAFXVXDKTZZJDV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|