C15H16N4OS3 — CID 121029761
N-[5-(3-methylbutylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide (PubChem CID 121029761) has the molecular formula C15H16N4OS3 and a molecular weight of 364.52 g/mol. Its IUPAC name is N-[5-(3-methylbutylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[5-(3-methylbutylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 121029761 |
| Molecular Formula | C15H16N4OS3 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | N-[5-(3-methylbutylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,3-benzothiazole-2-carboxamide |
| SMILES | CC(C)CCSc1nnc(NC(=O)c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C15H16N4OS3/c1-9(2)7-8-21-15-19-18-14(23-15)17-12(20)13-16-10-5-3-4-6-11(10)22-13/h3-6,9H,7-8H2,1-2H3,(H,17,18,20) |
| InChIKey | IJIRQAPSSACDIZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|