C13H11N5O2S4 — CID 6492842
2-[[5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 6492842) has the molecular formula C13H11N5O2S4 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-[[5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6492842 |
| Molecular Formula | C13H11N5O2S4 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2-[[5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nnc(NC(=O)CSc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C13H11N5O2S4/c14-9(19)5-21-13-18-17-11(24-13)16-10(20)6-22-12-15-7-3-1-2-4-8(7)23-12/h1-4H,5-6H2,(H2,14,19)(H,16,17,20) |
| InChIKey | DKPLUBJNRUDQHT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|