C13H15NO2S — CID 143934756
1-(1,3-benzothiazol-2-yl)pentan-1-one;formaldehyde (PubChem CID 143934756) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)pentan-1-one;formaldehyde.
| Compound Name | 1-(1,3-benzothiazol-2-yl)pentan-1-one;formaldehyde |
|---|---|
| PubChem CID | 143934756 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)pentan-1-one;formaldehyde |
| SMILES | C=O.CCCCC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NOS.CH2O/c1-2-3-7-10(14)12-13-9-6-4-5-8-11(9)15-12;1-2/h4-6,8H,2-3,7H2,1H3;1H2 |
| InChIKey | NLGSKOJEDXPGPE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |