C16H21NOS — CID 126704371
1-(1,3-benzothiazol-2-yl)-2,2,4,4-tetramethylpentan-1-one (PubChem CID 126704371) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2,2,4,4-tetramethylpentan-1-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2,2,4,4-tetramethylpentan-1-one |
|---|---|
| PubChem CID | 126704371 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2,2,4,4-tetramethylpentan-1-one |
| SMILES | CC(C)(C)CC(C)(C)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H21NOS/c1-15(2,3)10-16(4,5)13(18)14-17-11-8-6-7-9-12(11)19-14/h6-9H,10H2,1-5H3 |
| InChIKey | NFAJRGFVKOPUMC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |