C25H38NNaO3S2 — CID 101138311
sodium 10-(1,3-benzothiazol-2-ylsulfanyl)-9-hydroxyoctadecanoate (PubChem CID 101138311) has the molecular formula C25H38NNaO3S2 and a molecular weight of 487.71 g/mol. Its IUPAC name is sodium 10-(1,3-benzothiazol-2-ylsulfanyl)-9-hydroxyoctadecanoate.
| Compound Name | sodium 10-(1,3-benzothiazol-2-ylsulfanyl)-9-hydroxyoctadecanoate |
|---|---|
| PubChem CID | 101138311 |
| Molecular Formula | C25H38NNaO3S2 |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | sodium 10-(1,3-benzothiazol-2-ylsulfanyl)-9-hydroxyoctadecanoate |
| SMILES | CCCCCCCCC(Sc1nc2ccccc2s1)C(O)CCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C25H39NO3S2.Na/c1-2-3-4-5-8-11-18-23(21(27)16-10-7-6-9-12-19-24(28)29)31-25-26-20-15-13-14-17-22(20)30-25;/h13-15,17,21,23,27H,2-12,16,18-19H2,1H3,(H,28,29);/q;+1/p-1 |
| InChIKey | UHNABWWMWKMAAO-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|