C20H28BrNO2S2 — CID 89263862
ethyl 2-(1,3-benzothiazol-2-ylsulfanyl)-3-bromoundecanoate (PubChem CID 89263862) has the molecular formula C20H28BrNO2S2 and a molecular weight of 458.49 g/mol. Its IUPAC name is ethyl 2-(1,3-benzothiazol-2-ylsulfanyl)-3-bromoundecanoate.
| Compound Name | ethyl 2-(1,3-benzothiazol-2-ylsulfanyl)-3-bromoundecanoate |
|---|---|
| PubChem CID | 89263862 |
| Molecular Formula | C20H28BrNO2S2 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | ethyl 2-(1,3-benzothiazol-2-ylsulfanyl)-3-bromoundecanoate |
| SMILES | CCCCCCCCC(Br)C(Sc1nc2ccccc2s1)C(=O)OCC |
| InChI | InChI=1S/C20H28BrNO2S2/c1-3-5-6-7-8-9-12-15(21)18(19(23)24-4-2)26-20-22-16-13-10-11-14-17(16)25-20/h10-11,13-15,18H,3-9,12H2,1-2H3 |
| InChIKey | QZXCABOFMAWIPV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|