C30H48N2O4S2 — CID 59731212
3-(1,3-benzothiazol-2-ylsulfanyl)-4-[3-(2-hexyldecoxy)propylamino]-4-oxobutanoic acid (PubChem CID 59731212) has the molecular formula C30H48N2O4S2 and a molecular weight of 564.86 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-4-[3-(2-hexyldecoxy)propylamino]-4-oxobutanoic acid.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-4-[3-(2-hexyldecoxy)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59731212 |
| Molecular Formula | C30H48N2O4S2 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-4-[3-(2-hexyldecoxy)propylamino]-4-oxobutanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)COCCCNC(=O)C(CC(=O)O)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C30H48N2O4S2/c1-3-5-7-9-10-12-17-24(16-11-8-6-4-2)23-36-21-15-20-31-29(35)27(22-28(33)34)38-30-32-25-18-13-14-19-26(25)37-30/h13-14,18-19,24,27H,3-12,15-17,20-23H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | ZBSBTIHOERQBDG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|