C16H19NO4S2 — CID 54243947
1-O-(1,3-benzothiazol-2-ylsulfanyl) 4-O-methyl 2-butylbutanedioate (PubChem CID 54243947) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-O-(1,3-benzothiazol-2-ylsulfanyl) 4-O-methyl 2-butylbutanedioate.
| Compound Name | 1-O-(1,3-benzothiazol-2-ylsulfanyl) 4-O-methyl 2-butylbutanedioate |
|---|---|
| PubChem CID | 54243947 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-O-(1,3-benzothiazol-2-ylsulfanyl) 4-O-methyl 2-butylbutanedioate |
| SMILES | CCCCC(CC(=O)OC)C(=O)OSc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H19NO4S2/c1-3-4-7-11(10-14(18)20-2)15(19)21-23-16-17-12-8-5-6-9-13(12)22-16/h5-6,8-9,11H,3-4,7,10H2,1-2H3 |
| InChIKey | QRXVIYURTQTGFH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|