C13H15NO4S2 — CID 115629693
methyl 3-(1,3-benzothiazol-2-ylmethylsulfonyl)butanoate (PubChem CID 115629693) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl 3-(1,3-benzothiazol-2-ylmethylsulfonyl)butanoate.
| Compound Name | methyl 3-(1,3-benzothiazol-2-ylmethylsulfonyl)butanoate |
|---|---|
| PubChem CID | 115629693 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | methyl 3-(1,3-benzothiazol-2-ylmethylsulfonyl)butanoate |
| SMILES | COC(=O)CC(C)S(=O)(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15NO4S2/c1-9(7-13(15)18-2)20(16,17)8-12-14-10-5-3-4-6-11(10)19-12/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | FUNJAQLKONVXRH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |