C11H11NO4S2 — CID 102543994
methyl 2-(1,3-benzothiazol-2-ylmethylsulfonyl)acetate (PubChem CID 102543994) has the molecular formula C11H11NO4S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is methyl 2-(1,3-benzothiazol-2-ylmethylsulfonyl)acetate.
| Compound Name | methyl 2-(1,3-benzothiazol-2-ylmethylsulfonyl)acetate |
|---|---|
| PubChem CID | 102543994 |
| Molecular Formula | C11H11NO4S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | methyl 2-(1,3-benzothiazol-2-ylmethylsulfonyl)acetate |
| SMILES | COC(=O)CS(=O)(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11NO4S2/c1-16-11(13)7-18(14,15)6-10-12-8-4-2-3-5-9(8)17-10/h2-5H,6-7H2,1H3 |
| InChIKey | CNTDEDFKKDZDKG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |